C13H6F6N2 — CID 154132650
6,8-bis(trifluoromethyl)-9H-pyrrolo[3,2-h]quinoline (PubChem CID 154132650) has the molecular formula C13H6F6N2 and a molecular weight of 304.19 g/mol. Its IUPAC name is 6,8-bis(trifluoromethyl)-9H-pyrrolo[3,2-h]quinoline.
| Compound Name | 6,8-bis(trifluoromethyl)-9H-pyrrolo[3,2-h]quinoline |
|---|---|
| PubChem CID | 154132650 |
| Molecular Formula | C13H6F6N2 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 6,8-bis(trifluoromethyl)-9H-pyrrolo[3,2-h]quinoline |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c2ccc3ccnc3c2[nH]1 |
| InChI | InChI=1S/C13H6F6N2/c14-12(15,16)8-5-9(13(17,18)19)21-11-7(8)2-1-6-3-4-20-10(6)11/h1-5,21H |
| InChIKey | XCLDPFFRXNKDHL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |