C12H7F3N2 — CID 137225245
2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinoline (PubChem CID 137225245) has the molecular formula C12H7F3N2 and a molecular weight of 236.20 g/mol. Its IUPAC name is 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinoline.
| Compound Name | 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinoline |
|---|---|
| PubChem CID | 137225245 |
| Molecular Formula | C12H7F3N2 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinoline |
| SMILES | FC(F)(F)c1ccc2ccc3nccc3c2[nH]1 |
| InChI | InChI=1S/C12H7F3N2/c13-12(14,15)10-4-2-7-1-3-9-8(5-6-16-9)11(7)17-10/h1-6,17H |
| InChIKey | UTAJMBXXFWNYIJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |