C11H5F3N2 — CID 137225246
2,3,4-trifluoro-1H-pyrrolo[2,3-h]quinoline (PubChem CID 137225246) has the molecular formula C11H5F3N2 and a molecular weight of 222.17 g/mol. Its IUPAC name is 2,3,4-trifluoro-1H-pyrrolo[2,3-h]quinoline.
| Compound Name | 2,3,4-trifluoro-1H-pyrrolo[2,3-h]quinoline |
|---|---|
| PubChem CID | 137225246 |
| Molecular Formula | C11H5F3N2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 2,3,4-trifluoro-1H-pyrrolo[2,3-h]quinoline |
| SMILES | Fc1[nH]c2c(ccc3nccc32)c(F)c1F |
| InChI | InChI=1S/C11H5F3N2/c12-8-6-1-2-7-5(3-4-15-7)10(6)16-11(14)9(8)13/h1-4,16H |
| InChIKey | XHOLMKXLBLWMCK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|