About 2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline
2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline (PubChem CID 140710850) has the molecular formula C14H12N2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline.
Molecular Properties
| Compound Name | 2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline |
| PubChem CID | 140710850 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline |
| SMILES | C=CCc1ccc2ccc3nccc3c2[nH]1 |
| InChI | InChI=1S/C14H12N2/c1-2-3-11-6-4-10-5-7-13-12(8-9-15-13)14(10)16-11/h2,4-9,16H,1,3H2 |
| InChIKey | KSFLNFAJQOGOEV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline?
The IUPAC name of 2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline (CID 140710850) is 2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline.
What is the SMILES notation for 2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline?
The canonical SMILES for 2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline is C=CCc1ccc2ccc3nccc3c2[nH]1.
What is the InChIKey of 2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline?
The InChIKey is KSFLNFAJQOGOEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2/c1-2-3-11-6-4-10-5-7-13-12(8-9-15-13)14(10)16-11/h2,4-9,16H,1,3H2.
What are the key properties of 2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline?
2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline has a molecular weight of 208.26 g/mol, XLogP of 3.44, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enyl-1H-pyrrolo[2,3-h]quinoline is sourced from PubChem (CID 140710850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).