C12H10N2 — CID 137183816
2-methyl-1H-pyrrolo[2,3-h]quinoline (PubChem CID 137183816) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-methyl-1H-pyrrolo[2,3-h]quinoline.
| Compound Name | 2-methyl-1H-pyrrolo[2,3-h]quinoline |
|---|---|
| PubChem CID | 137183816 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 2-methyl-1H-pyrrolo[2,3-h]quinoline |
| SMILES | Cc1ccc2ccc3nccc3c2[nH]1 |
| InChI | InChI=1S/C12H10N2/c1-8-2-3-9-4-5-11-10(6-7-13-11)12(9)14-8/h2-7,14H,1H3 |
| InChIKey | BIMIWDCIMMTLQB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |