C13H9N3 — CID 139641490
2-(1H-pyrrolo[2,3-h]quinolin-2-yl)acetonitrile (PubChem CID 139641490) has the molecular formula C13H9N3 and a molecular weight of 207.24 g/mol. Its IUPAC name is 2-(1H-pyrrolo[2,3-h]quinolin-2-yl)acetonitrile.
| Compound Name | 2-(1H-pyrrolo[2,3-h]quinolin-2-yl)acetonitrile |
|---|---|
| PubChem CID | 139641490 |
| Molecular Formula | C13H9N3 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 2-(1H-pyrrolo[2,3-h]quinolin-2-yl)acetonitrile |
| SMILES | N#CCc1ccc2ccc3nccc3c2[nH]1 |
| InChI | InChI=1S/C13H9N3/c14-7-5-10-3-1-9-2-4-12-11(6-8-15-12)13(9)16-10/h1-4,6,8,16H,5H2 |
| InChIKey | NMQMZOCDSVTIRA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |