C13H13Cl4NO3 — CID 154132956
methyl N-[3,5-dichloro-4-[(2,2-dichloro-1-methylcyclopropyl)methoxy]phenyl]carbamate (PubChem CID 154132956) has the molecular formula C13H13Cl4NO3 and a molecular weight of 373.06 g/mol. Its IUPAC name is methyl N-[3,5-dichloro-4-[(2,2-dichloro-1-methylcyclopropyl)methoxy]phenyl]carbamate.
| Compound Name | methyl N-[3,5-dichloro-4-[(2,2-dichloro-1-methylcyclopropyl)methoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 154132956 |
| Molecular Formula | C13H13Cl4NO3 |
| Molecular Weight | 373.06 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | methyl N-[3,5-dichloro-4-[(2,2-dichloro-1-methylcyclopropyl)methoxy]phenyl]carbamate |
| SMILES | COC(=O)Nc1cc(Cl)c(OCC2(C)CC2(Cl)Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl4NO3/c1-12(5-13(12,16)17)6-21-10-8(14)3-7(4-9(10)15)18-11(19)20-2/h3-4H,5-6H2,1-2H3,(H,18,19) |
| InChIKey | DUCNKOKNCGHHIR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.06 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|