C15H19ClN2O5 — CID 13421313
methyl N-[5-(but-3-en-2-yloxycarbonylamino)-3-chloro-2-ethoxyphenyl]carbamate (PubChem CID 13421313) has the molecular formula C15H19ClN2O5 and a molecular weight of 342.78 g/mol. Its IUPAC name is methyl N-[5-(but-3-en-2-yloxycarbonylamino)-3-chloro-2-ethoxyphenyl]carbamate.
| Compound Name | methyl N-[5-(but-3-en-2-yloxycarbonylamino)-3-chloro-2-ethoxyphenyl]carbamate |
|---|---|
| PubChem CID | 13421313 |
| Molecular Formula | C15H19ClN2O5 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | methyl N-[5-(but-3-en-2-yloxycarbonylamino)-3-chloro-2-ethoxyphenyl]carbamate |
| SMILES | C=CC(C)OC(=O)Nc1cc(Cl)c(OCC)c(NC(=O)OC)c1 |
| InChI | InChI=1S/C15H19ClN2O5/c1-5-9(3)23-15(20)17-10-7-11(16)13(22-6-2)12(8-10)18-14(19)21-4/h5,7-9H,1,6H2,2-4H3,(H,17,20)(H,18,19) |
| InChIKey | GNKUQGKAHQMUBI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|