C18H24OSi — CID 154136767
3,3-diphenylpropyl(propoxy)silane (PubChem CID 154136767) has the molecular formula C18H24OSi and a molecular weight of 284.48 g/mol. Its IUPAC name is 3,3-diphenylpropyl(propoxy)silane.
| Compound Name | 3,3-diphenylpropyl(propoxy)silane |
|---|---|
| PubChem CID | 154136767 |
| Molecular Formula | C18H24OSi |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 3,3-diphenylpropyl(propoxy)silane |
| SMILES | CCCO[SiH2]CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H24OSi/c1-2-14-19-20-15-13-18(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,18H,2,13-15,20H2,1H3 |
| InChIKey | WMXGIIVXXAZGQP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|