C36H46O2Si2 — CID 154430427
4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)butyl]silane (PubChem CID 154430427) has the molecular formula C36H46O2Si2 and a molecular weight of 566.93 g/mol. Its IUPAC name is 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)butyl]silane.
| Compound Name | 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)butyl]silane |
|---|---|
| PubChem CID | 154430427 |
| Molecular Formula | C36H46O2Si2 |
| Molecular Weight | 566.93 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)butyl]silane |
| SMILES | c1ccc(C(CCCO[SiH2]CCCC[SiH2]OCCCC(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H46O2Si2/c1-5-17-31(18-6-1)35(32-19-7-2-8-20-32)25-15-27-37-39-29-13-14-30-40-38-28-16-26-36(33-21-9-3-10-22-33)34-23-11-4-12-24-34/h1-12,17-24,35-36H,13-16,25-30,39-40H2 |
| InChIKey | RPVAPABRXYBFPG-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.93 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|