C16H19O3PS — CID 54339531
4,4-diphenylbutoxy-dihydroxy-sulfanylidene-λ5-phosphane (PubChem CID 54339531) has the molecular formula C16H19O3PS and a molecular weight of 322.37 g/mol. Its IUPAC name is 4,4-diphenylbutoxy-dihydroxy-sulfanylidene-λ5-phosphane.
| Compound Name | 4,4-diphenylbutoxy-dihydroxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 54339531 |
| Molecular Formula | C16H19O3PS |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4,4-diphenylbutoxy-dihydroxy-sulfanylidene-λ5-phosphane |
| SMILES | OP(O)(=S)OCCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H19O3PS/c17-20(18,21)19-13-7-12-16(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16H,7,12-13H2,(H2,17,18,21) |
| InChIKey | TXYKHBFWIUDKGE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|