About 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane
4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane (PubChem CID 154430428) has the molecular formula C38H42O2Si2
and a molecular weight of 586.92 g/mol. Its IUPAC name is 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane.
Molecular Properties
| Compound Name | 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane |
| PubChem CID | 154430428 |
| Molecular Formula | C38H42O2Si2 |
| Molecular Weight | 586.92 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane |
| SMILES | c1ccc(C(CCCO[SiH2]c2ccc([SiH2]OCCCC(c3ccccc3)c3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H42O2Si2/c1-5-15-31(16-6-1)37(32-17-7-2-8-18-32)23-13-29-39-41-35-25-27-36(28-26-35)42-40-30-14-24-38(33-19-9-3-10-20-33)34-21-11-4-12-22-34/h1-12,15-22,25-28,37-38H,13-14,23-24,29-30,41-42H2 |
| InChIKey | XZYNLLGNZKYDHN-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.92 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane?
The IUPAC name of 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane (CID 154430428) is 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane.
What is the SMILES notation for 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane?
The canonical SMILES for 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane is c1ccc(C(CCCO[SiH2]c2ccc([SiH2]OCCCC(c3ccccc3)c3ccccc3)cc2)c2ccccc2)cc1.
What is the InChIKey of 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane?
The InChIKey is XZYNLLGNZKYDHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H42O2Si2/c1-5-15-31(16-6-1)37(32-17-7-2-8-18-32)23-13-29-39-41-35-25-27-36(28-26-35)42-40-30-14-24-38(33-19-9-3-10-20-33)34-21-11-4-12-22-34/h1-12,15-22,25-28,37-38H,13-14,23-24,29-30,41-42H2.
What are the key properties of 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane?
4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane has a molecular weight of 586.92 g/mol, XLogP of 6.36, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diphenylbutoxy-[4-(4,4-diphenylbutoxysilyl)phenyl]silane is sourced from PubChem (CID 154430428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).