C17H22OSi — CID 154101228
3,3-diphenylpropyl(ethoxy)silane (PubChem CID 154101228) has the molecular formula C17H22OSi and a molecular weight of 270.45 g/mol. Its IUPAC name is 3,3-diphenylpropyl(ethoxy)silane.
| Compound Name | 3,3-diphenylpropyl(ethoxy)silane |
|---|---|
| PubChem CID | 154101228 |
| Molecular Formula | C17H22OSi |
| Molecular Weight | 270.45 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3,3-diphenylpropyl(ethoxy)silane |
| SMILES | CCO[SiH2]CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H22OSi/c1-2-18-19-14-13-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17H,2,13-14,19H2,1H3 |
| InChIKey | KTOLDYVBTYEUGU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|