C15H17BrSi — CID 123512545
bromo(3,3-diphenylpropyl)silane (PubChem CID 123512545) has the molecular formula C15H17BrSi and a molecular weight of 305.29 g/mol. Its IUPAC name is bromo(3,3-diphenylpropyl)silane.
| Compound Name | bromo(3,3-diphenylpropyl)silane |
|---|---|
| PubChem CID | 123512545 |
| Molecular Formula | C15H17BrSi |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | bromo(3,3-diphenylpropyl)silane |
| SMILES | Br[SiH2]CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H17BrSi/c16-17-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12,17H2 |
| InChIKey | HDKPWMFTHXIDPW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|