About bromo(3,3-diphenylpropyl)silane
bromo(3,3-diphenylpropyl)silane (PubChem CID 123512545) has the molecular formula C15H17BrSi
and a molecular weight of 305.29 g/mol. Its IUPAC name is bromo(3,3-diphenylpropyl)silane.
Molecular Properties
| Compound Name | bromo(3,3-diphenylpropyl)silane |
| PubChem CID | 123512545 |
| Molecular Formula | C15H17BrSi |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | bromo(3,3-diphenylpropyl)silane |
| SMILES | Br[SiH2]CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H17BrSi/c16-17-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12,17H2 |
| InChIKey | HDKPWMFTHXIDPW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze bromo(3,3-diphenylpropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo(3,3-diphenylpropyl)silane?
The IUPAC name of bromo(3,3-diphenylpropyl)silane (CID 123512545) is bromo(3,3-diphenylpropyl)silane.
What is the SMILES notation for bromo(3,3-diphenylpropyl)silane?
The canonical SMILES for bromo(3,3-diphenylpropyl)silane is Br[SiH2]CCC(c1ccccc1)c1ccccc1.
What is the InChIKey of bromo(3,3-diphenylpropyl)silane?
The InChIKey is HDKPWMFTHXIDPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BrSi/c16-17-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12,17H2.
What are the key properties of bromo(3,3-diphenylpropyl)silane?
bromo(3,3-diphenylpropyl)silane has a molecular weight of 305.29 g/mol, XLogP of 4.11, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromo(3,3-diphenylpropyl)silane is sourced from PubChem (CID 123512545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).