C32H36BNaO3 — CID 173096252
sodium;bis(4,4-diphenylbutoxy)borinic acid;hydride (PubChem CID 173096252) has the molecular formula C32H36BNaO3 and a molecular weight of 502.44 g/mol. Its IUPAC name is sodium;bis(4,4-diphenylbutoxy)borinic acid;hydride.
| Compound Name | sodium;bis(4,4-diphenylbutoxy)borinic acid;hydride |
|---|---|
| PubChem CID | 173096252 |
| Molecular Formula | C32H36BNaO3 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | sodium;bis(4,4-diphenylbutoxy)borinic acid;hydride |
| SMILES | OB(OCCCC(c1ccccc1)c1ccccc1)OCCCC(c1ccccc1)c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C32H35BO3.Na.H/c34-33(35-25-13-23-31(27-15-5-1-6-16-27)28-17-7-2-8-18-28)36-26-14-24-32(29-19-9-3-10-20-29)30-21-11-4-12-22-30;;/h1-12,15-22,31-32,34H,13-14,23-26H2;;/q;+1;-1 |
| InChIKey | QLEPZLHBXYGXKA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|