C48H67BO3 — CID 56986671
bis[4,4-bis(4-tert-butylphenyl)butoxy]borinic acid (PubChem CID 56986671) has the molecular formula C48H67BO3 and a molecular weight of 702.87 g/mol. Its IUPAC name is bis[4,4-bis(4-tert-butylphenyl)butoxy]borinic acid.
| Compound Name | bis[4,4-bis(4-tert-butylphenyl)butoxy]borinic acid |
|---|---|
| PubChem CID | 56986671 |
| Molecular Formula | C48H67BO3 |
| Molecular Weight | 702.87 g/mol |
| Exact Mass | 702.52 |
| IUPAC Name | bis[4,4-bis(4-tert-butylphenyl)butoxy]borinic acid |
| SMILES | CC(C)(C)c1ccc(C(CCCOB(O)OCCCC(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C48H67BO3/c1-45(2,3)39-25-17-35(18-26-39)43(36-19-27-40(28-20-36)46(4,5)6)15-13-33-51-49(50)52-34-14-16-44(37-21-29-41(30-22-37)47(7,8)9)38-23-31-42(32-24-38)48(10,11)12/h17-32,43-44,50H,13-16,33-34H2,1-12H3 |
| InChIKey | MCVMAECFIGMOGU-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.87 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|