3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid

C10H5Cl2FO5 — CID 154161826

IUPAC3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid
SMILESO=C(O)CC(=O)OC(=O)c1cc(F)c(Cl)cc1Cl
InChIInChI=1S/C10H5Cl2FO5/c11-5-2-6(12)7(13)1-4(5)10(17)18-9(16)3-8(14)15/h1-2H,3H2,(H,14,15)
InChIKeyRJCBKVASOXWNGI-UHFFFAOYSA-N
MW295.05 g/mol
LogP2.29
Rot. Bonds3

About 3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid

3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid (PubChem CID 154161826) has the molecular formula C10H5Cl2FO5 and a molecular weight of 295.05 g/mol. Its IUPAC name is 3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid.

Molecular Properties

Compound Name3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid
PubChem CID154161826
Molecular FormulaC10H5Cl2FO5
Molecular Weight295.05 g/mol
Exact Mass293.95
IUPAC Name3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid
SMILESO=C(O)CC(=O)OC(=O)c1cc(F)c(Cl)cc1Cl
InChIInChI=1S/C10H5Cl2FO5/c11-5-2-6(12)7(13)1-4(5)10(17)18-9(16)3-8(14)15/h1-2H,3H2,(H,14,15)
InChIKeyRJCBKVASOXWNGI-UHFFFAOYSA-N
XLogP2.29
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.05
LogP ≤ 52.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid?
The IUPAC name of 3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid (CID 154161826) is 3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid.
What is the SMILES notation for 3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid?
The canonical SMILES for 3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid is O=C(O)CC(=O)OC(=O)c1cc(F)c(Cl)cc1Cl.
What is the InChIKey of 3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid?
The InChIKey is RJCBKVASOXWNGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl2FO5/c11-5-2-6(12)7(13)1-4(5)10(17)18-9(16)3-8(14)15/h1-2H,3H2,(H,14,15).
What are the key properties of 3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid?
3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid has a molecular weight of 295.05 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dichloro-5-fluorobenzoyl)oxy-3-oxopropanoic acid is sourced from PubChem (CID 154161826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).