C10H3Cl2F4O2- — CID 154177256
3-[2,6-dichloro-3-(trifluoromethyl)phenyl]-2-fluoroprop-2-enoate (PubChem CID 154177256) has the molecular formula C10H3Cl2F4O2- and a molecular weight of 302.03 g/mol. Its IUPAC name is 3-[2,6-dichloro-3-(trifluoromethyl)phenyl]-2-fluoroprop-2-enoate.
| Compound Name | 3-[2,6-dichloro-3-(trifluoromethyl)phenyl]-2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 154177256 |
| Molecular Formula | C10H3Cl2F4O2- |
| Molecular Weight | 302.03 g/mol |
| Exact Mass | 300.95 |
| IUPAC Name | 3-[2,6-dichloro-3-(trifluoromethyl)phenyl]-2-fluoroprop-2-enoate |
| SMILES | O=C([O-])C(F)=Cc1c(Cl)ccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C10H4Cl2F4O2/c11-6-2-1-5(10(14,15)16)8(12)4(6)3-7(13)9(17)18/h1-3H,(H,17,18)/p-1 |
| InChIKey | CFNRDRMLKMVRFM-UHFFFAOYSA-M |
| XLogP | 3.07 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.03 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|