C13H9Cl3N2O4 — CID 154185441
3,5,6-trichloro-6-hydroxy-4-nitro-N-phenylcyclohexa-2,4-diene-1-carboxamide (PubChem CID 154185441) has the molecular formula C13H9Cl3N2O4 and a molecular weight of 363.58 g/mol. Its IUPAC name is 3,5,6-trichloro-6-hydroxy-4-nitro-N-phenylcyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 3,5,6-trichloro-6-hydroxy-4-nitro-N-phenylcyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 154185441 |
| Molecular Formula | C13H9Cl3N2O4 |
| Molecular Weight | 363.58 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | 3,5,6-trichloro-6-hydroxy-4-nitro-N-phenylcyclohexa-2,4-diene-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1C=C(Cl)C([N+](=O)[O-])=C(Cl)C1(O)Cl |
| InChI | InChI=1S/C13H9Cl3N2O4/c14-9-6-8(12(19)17-7-4-2-1-3-5-7)13(16,20)11(15)10(9)18(21)22/h1-6,8,20H,(H,17,19) |
| InChIKey | GIIIDAZGVLEGRX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|