C17H23NO4 — CID 154188425
(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate (PubChem CID 154188425) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate.
| Compound Name | (1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 154188425 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C(=O)OCN2C(=O)C3CC=CCC3C2=O)C1(C)C |
| InChI | InChI=1S/C17H23NO4/c1-16(2)12(17(16,3)4)15(21)22-9-18-13(19)10-7-5-6-8-11(10)14(18)20/h5-6,10-12H,7-9H2,1-4H3 |
| InChIKey | PWGSFLCGXYSKRF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|