C12H5Br4ClO3S — CID 154189341
(2,3,5,6-tetrabromo-4-chlorophenyl) benzenesulfonate (PubChem CID 154189341) has the molecular formula C12H5Br4ClO3S and a molecular weight of 584.31 g/mol. Its IUPAC name is (2,3,5,6-tetrabromo-4-chlorophenyl) benzenesulfonate.
| Compound Name | (2,3,5,6-tetrabromo-4-chlorophenyl) benzenesulfonate |
|---|---|
| PubChem CID | 154189341 |
| Molecular Formula | C12H5Br4ClO3S |
| Molecular Weight | 584.31 g/mol |
| Exact Mass | 579.64 |
| IUPAC Name | (2,3,5,6-tetrabromo-4-chlorophenyl) benzenesulfonate |
| SMILES | O=S(=O)(Oc1c(Br)c(Br)c(Cl)c(Br)c1Br)c1ccccc1 |
| InChI | InChI=1S/C12H5Br4ClO3S/c13-7-9(15)12(10(16)8(14)11(7)17)20-21(18,19)6-4-2-1-3-5-6/h1-5H |
| InChIKey | JNSAWHCWOBUYGO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.31 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|