C13H10Br2O4S — CID 126142703
[2,6-dibromo-4-(hydroxymethyl)phenyl] benzenesulfonate (PubChem CID 126142703) has the molecular formula C13H10Br2O4S and a molecular weight of 422.09 g/mol. Its IUPAC name is [2,6-dibromo-4-(hydroxymethyl)phenyl] benzenesulfonate.
| Compound Name | [2,6-dibromo-4-(hydroxymethyl)phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126142703 |
| Molecular Formula | C13H10Br2O4S |
| Molecular Weight | 422.09 g/mol |
| Exact Mass | 419.87 |
| IUPAC Name | [2,6-dibromo-4-(hydroxymethyl)phenyl] benzenesulfonate |
| SMILES | O=S(=O)(Oc1c(Br)cc(CO)cc1Br)c1ccccc1 |
| InChI | InChI=1S/C13H10Br2O4S/c14-11-6-9(8-16)7-12(15)13(11)19-20(17,18)10-4-2-1-3-5-10/h1-7,16H,8H2 |
| InChIKey | UKYGLDGWFUSPTB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.09 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|