C7H17NO10P2S — CID 154193474
S-(3-amino-4-hydroxy-2-methyl-4,4-diphosphonooxybutan-2-yl) ethanethioate (PubChem CID 154193474) has the molecular formula C7H17NO10P2S and a molecular weight of 369.23 g/mol. Its IUPAC name is S-(3-amino-4-hydroxy-2-methyl-4,4-diphosphonooxybutan-2-yl) ethanethioate.
| Compound Name | S-(3-amino-4-hydroxy-2-methyl-4,4-diphosphonooxybutan-2-yl) ethanethioate |
|---|---|
| PubChem CID | 154193474 |
| Molecular Formula | C7H17NO10P2S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | S-(3-amino-4-hydroxy-2-methyl-4,4-diphosphonooxybutan-2-yl) ethanethioate |
| SMILES | CC(=O)SC(C)(C)C(N)C(O)(OP(=O)(O)O)OP(=O)(O)O |
| InChI | InChI=1S/C7H17NO10P2S/c1-4(9)21-6(2,3)5(8)7(10,17-19(11,12)13)18-20(14,15)16/h5,10H,8H2,1-3H3,(H2,11,12,13)(H2,14,15,16) |
| InChIKey | XEZGPVFAZDDKGE-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 196.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|