C18H36N2O4Si2 — CID 154194478
1-N,4-N-bis(3-dimethoxysilylbutyl)benzene-1,4-diamine (PubChem CID 154194478) has the molecular formula C18H36N2O4Si2 and a molecular weight of 400.67 g/mol. Its IUPAC name is 1-N,4-N-bis(3-dimethoxysilylbutyl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(3-dimethoxysilylbutyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 154194478 |
| Molecular Formula | C18H36N2O4Si2 |
| Molecular Weight | 400.67 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1-N,4-N-bis(3-dimethoxysilylbutyl)benzene-1,4-diamine |
| SMILES | CO[SiH](OC)C(C)CCNc1ccc(NCCC(C)[SiH](OC)OC)cc1 |
| InChI | InChI=1S/C18H36N2O4Si2/c1-15(25(21-3)22-4)11-13-19-17-7-9-18(10-8-17)20-14-12-16(2)26(23-5)24-6/h7-10,15-16,19-20,25-26H,11-14H2,1-6H3 |
| InChIKey | MFNDOLFUWLGSAV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.67 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|