C24H48N2O4Si2 — CID 154210482
1-N,4-N-bis(3-diethoxysilylpentyl)benzene-1,4-diamine (PubChem CID 154210482) has the molecular formula C24H48N2O4Si2 and a molecular weight of 484.83 g/mol. Its IUPAC name is 1-N,4-N-bis(3-diethoxysilylpentyl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(3-diethoxysilylpentyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 154210482 |
| Molecular Formula | C24H48N2O4Si2 |
| Molecular Weight | 484.83 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 1-N,4-N-bis(3-diethoxysilylpentyl)benzene-1,4-diamine |
| SMILES | CCO[SiH](OCC)C(CC)CCNc1ccc(NCCC(CC)[SiH](OCC)OCC)cc1 |
| InChI | InChI=1S/C24H48N2O4Si2/c1-7-23(31(27-9-3)28-10-4)17-19-25-21-13-15-22(16-14-21)26-20-18-24(8-2)32(29-11-5)30-12-6/h13-16,23-26,31-32H,7-12,17-20H2,1-6H3 |
| InChIKey | FIRBTPTXIACGNQ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.83 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|