C19H28N4O3 — CID 142613544
1,3-bis[4-(1-hydroxyethylamino)anilino]propan-1-ol (PubChem CID 142613544) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1,3-bis[4-(1-hydroxyethylamino)anilino]propan-1-ol.
| Compound Name | 1,3-bis[4-(1-hydroxyethylamino)anilino]propan-1-ol |
|---|---|
| PubChem CID | 142613544 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1,3-bis[4-(1-hydroxyethylamino)anilino]propan-1-ol |
| SMILES | CC(O)Nc1ccc(NCCC(O)Nc2ccc(NC(C)O)cc2)cc1 |
| InChI | InChI=1S/C19H28N4O3/c1-13(24)21-16-5-3-15(4-6-16)20-12-11-19(26)23-18-9-7-17(8-10-18)22-14(2)25/h3-10,13-14,19-26H,11-12H2,1-2H3 |
| InChIKey | LNIHBXDIZFZYET-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|