C14H9Cl6N9O3 — CID 154200189
2,4-dichloro-6-[3-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]-2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxymethyl]-2-methylpropoxy]-1,3,5-triazine (PubChem CID 154200189) has the molecular formula C14H9Cl6N9O3 and a molecular weight of 564.00 g/mol. Its IUPAC name is 2,4-dichloro-6-[3-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]-2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxymethyl]-2-methylpropoxy]-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-[3-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]-2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxymethyl]-2-methylpropoxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 154200189 |
| Molecular Formula | C14H9Cl6N9O3 |
| Molecular Weight | 564.00 g/mol |
| Exact Mass | 560.90 |
| IUPAC Name | 2,4-dichloro-6-[3-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]-2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxymethyl]-2-methylpropoxy]-1,3,5-triazine |
| SMILES | CC(COc1nc(Cl)nc(Cl)n1)(COc1nc(Cl)nc(Cl)n1)COc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C14H9Cl6N9O3/c1-14(2-30-11-24-5(15)21-6(16)25-11,3-31-12-26-7(17)22-8(18)27-12)4-32-13-28-9(19)23-10(20)29-13/h2-4H2,1H3 |
| InChIKey | AQXGIWJNDXJQGH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 143.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.00 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |