C3Cl2IN3O — CID 90346653
(4,6-dichloro-1,3,5-triazin-2-yl) hypoiodite (PubChem CID 90346653) has the molecular formula C3Cl2IN3O and a molecular weight of 291.86 g/mol. Its IUPAC name is (4,6-dichloro-1,3,5-triazin-2-yl) hypoiodite.
| Compound Name | (4,6-dichloro-1,3,5-triazin-2-yl) hypoiodite |
|---|---|
| PubChem CID | 90346653 |
| Molecular Formula | C3Cl2IN3O |
| Molecular Weight | 291.86 g/mol |
| Exact Mass | 290.85 |
| IUPAC Name | (4,6-dichloro-1,3,5-triazin-2-yl) hypoiodite |
| SMILES | Clc1nc(Cl)nc(OI)n1 |
| InChI | InChI=1S/C3Cl2IN3O/c4-1-7-2(5)9-3(8-1)10-6 |
| InChIKey | KWZWFUJJVBIRLA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.86 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|