C16H23N2O5PS — CID 154218703
tert-butyl (2S)-2-amino-2-benzyl-3-oxo-3-[(2-oxo-1,3,2λ5-oxathiaphospholan-2-yl)amino]propanoate (PubChem CID 154218703) has the molecular formula C16H23N2O5PS and a molecular weight of 386.41 g/mol. Its IUPAC name is tert-butyl (2S)-2-amino-2-benzyl-3-oxo-3-[(2-oxo-1,3,2λ5-oxathiaphospholan-2-yl)amino]propanoate.
| Compound Name | tert-butyl (2S)-2-amino-2-benzyl-3-oxo-3-[(2-oxo-1,3,2λ5-oxathiaphospholan-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 154218703 |
| Molecular Formula | C16H23N2O5PS |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | tert-butyl (2S)-2-amino-2-benzyl-3-oxo-3-[(2-oxo-1,3,2λ5-oxathiaphospholan-2-yl)amino]propanoate |
| SMILES | CC(C)(C)OC(=O)[C@](N)(Cc1ccccc1)C(=O)NP1(=O)OCCS1 |
| InChI | InChI=1S/C16H23N2O5PS/c1-15(2,3)23-14(20)16(17,11-12-7-5-4-6-8-12)13(19)18-24(21)22-9-10-25-24/h4-8H,9-11,17H2,1-3H3,(H,18,19,21)/t16-,24?/m0/s1 |
| InChIKey | KPDJZXUJNLHOPB-FXIRQEPWSA-N |
| XLogP | 2.26 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|