C9H17N2+ — CID 154222841
1-butyl-2,4-dimethyl-1H-imidazol-1-ium (PubChem CID 154222841) has the molecular formula C9H17N2+ and a molecular weight of 153.25 g/mol. Its IUPAC name is 1-butyl-2,4-dimethyl-1H-imidazol-1-ium.
| Compound Name | 1-butyl-2,4-dimethyl-1H-imidazol-1-ium |
|---|---|
| PubChem CID | 154222841 |
| Molecular Formula | C9H17N2+ |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.14 |
| IUPAC Name | 1-butyl-2,4-dimethyl-1H-imidazol-1-ium |
| SMILES | CCCC[NH+]1C=C(C)N=C1C |
| InChI | InChI=1S/C9H16N2/c1-4-5-6-11-7-8(2)10-9(11)3/h7H,4-6H2,1-3H3/p+1 |
| InChIKey | KDZMZTIERFXHBN-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |