C18H19NS — CID 154224029
4-(2H-cyclohepta[e][1]benzothiol-3-ylidene)piperidine (PubChem CID 154224029) has the molecular formula C18H19NS and a molecular weight of 281.42 g/mol. Its IUPAC name is 4-(2H-cyclohepta[e][1]benzothiol-3-ylidene)piperidine.
| Compound Name | 4-(2H-cyclohepta[e][1]benzothiol-3-ylidene)piperidine |
|---|---|
| PubChem CID | 154224029 |
| Molecular Formula | C18H19NS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4-(2H-cyclohepta[e][1]benzothiol-3-ylidene)piperidine |
| SMILES | C1=CC=c2c(ccc3c2=CCS3=C2CCNCC2)C=C1 |
| InChI | InChI=1S/C18H19NS/c1-2-4-14-6-7-18-17(16(14)5-3-1)10-13-20(18)15-8-11-19-12-9-15/h1-7,10,19H,8-9,11-13H2 |
| InChIKey | LGPJQAJDEAAABN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|