C35H40N2O6 — CID 154226575
[4-[4-(4-formylphenoxy)but-1-enyl]-2-phenylphenyl]-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamic acid (PubChem CID 154226575) has the molecular formula C35H40N2O6 and a molecular weight of 584.71 g/mol. Its IUPAC name is [4-[4-(4-formylphenoxy)but-1-enyl]-2-phenylphenyl]-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamic acid.
| Compound Name | [4-[4-(4-formylphenoxy)but-1-enyl]-2-phenylphenyl]-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 154226575 |
| Molecular Formula | C35H40N2O6 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | [4-[4-(4-formylphenoxy)but-1-enyl]-2-phenylphenyl]-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)NC1CCC(N(C(=O)O)c2ccc(C=CCCOc3ccc(C=O)cc3)cc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C35H40N2O6/c1-35(2,3)43-33(39)36-28-15-17-29(18-16-28)37(34(40)41)32-21-14-25(23-31(32)27-10-5-4-6-11-27)9-7-8-22-42-30-19-12-26(24-38)13-20-30/h4-7,9-14,19-21,23-24,28-29H,8,15-18,22H2,1-3H3,(H,36,39)(H,40,41) |
| InChIKey | RLAWKFLCDHRFQY-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|