C35H39N3O5 — CID 90240318
[4-(tert-butylamino)cyclohexyl] N-[4-[(E)-4-(6-formyl-2-oxo-1,3-benzoxazol-3-yl)but-1-enyl]-2-phenylphenyl]carbamate (PubChem CID 90240318) has the molecular formula C35H39N3O5 and a molecular weight of 581.71 g/mol. Its IUPAC name is [4-(tert-butylamino)cyclohexyl] N-[4-[(E)-4-(6-formyl-2-oxo-1,3-benzoxazol-3-yl)but-1-enyl]-2-phenylphenyl]carbamate.
| Compound Name | [4-(tert-butylamino)cyclohexyl] N-[4-[(E)-4-(6-formyl-2-oxo-1,3-benzoxazol-3-yl)but-1-enyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 90240318 |
| Molecular Formula | C35H39N3O5 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | [4-(tert-butylamino)cyclohexyl] N-[4-[(E)-4-(6-formyl-2-oxo-1,3-benzoxazol-3-yl)but-1-enyl]-2-phenylphenyl]carbamate |
| SMILES | CC(C)(C)NC1CCC(OC(=O)Nc2ccc(/C=C/CCn3c(=O)oc4cc(C=O)ccc43)cc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C35H39N3O5/c1-35(2,3)37-27-14-16-28(17-15-27)42-33(40)36-30-18-12-24(21-29(30)26-10-5-4-6-11-26)9-7-8-20-38-31-19-13-25(23-39)22-32(31)43-34(38)41/h4-7,9-13,18-19,21-23,27-28,37H,8,14-17,20H2,1-3H3,(H,36,40)/b9-7+ |
| InChIKey | OBNDLCCSNMQARB-VQHVLOKHSA-N |
| XLogP | 7.43 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|