C28H34N2O3 — CID 59201768
tert-butyl N-[4-[benzyl(1H-indene-2-carbonyl)amino]cyclohexyl]carbamate (PubChem CID 59201768) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is tert-butyl N-[4-[benzyl(1H-indene-2-carbonyl)amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[benzyl(1H-indene-2-carbonyl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 59201768 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | tert-butyl N-[4-[benzyl(1H-indene-2-carbonyl)amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(N(Cc2ccccc2)C(=O)C2=Cc3ccccc3C2)CC1 |
| InChI | InChI=1S/C28H34N2O3/c1-28(2,3)33-27(32)29-24-13-15-25(16-14-24)30(19-20-9-5-4-6-10-20)26(31)23-17-21-11-7-8-12-22(21)18-23/h4-12,17,24-25H,13-16,18-19H2,1-3H3,(H,29,32) |
| InChIKey | RTBTXJHJOPPSAA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |