C20H26N7O15P3 — CID 154243583
[[(2R,3S,5R)-5-[2-amino-6-[[4-(3-aminoprop-1-ynyl)-2-nitrophenyl]methyl]-6-hydroxy-3H-purin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 154243583) has the molecular formula C20H26N7O15P3 and a molecular weight of 697.38 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-[2-amino-6-[[4-(3-aminoprop-1-ynyl)-2-nitrophenyl]methyl]-6-hydroxy-3H-purin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-[2-amino-6-[[4-(3-aminoprop-1-ynyl)-2-nitrophenyl]methyl]-6-hydroxy-3H-purin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 154243583 |
| Molecular Formula | C20H26N7O15P3 |
| Molecular Weight | 697.38 g/mol |
| Exact Mass | 697.07 |
| IUPAC Name | [[(2R,3S,5R)-5-[2-amino-6-[[4-(3-aminoprop-1-ynyl)-2-nitrophenyl]methyl]-6-hydroxy-3H-purin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NCC#Cc1ccc(CC2(O)N=C(N)Nc3c2ncn3[C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H26N7O15P3/c21-5-1-2-11-3-4-12(13(6-11)27(30)31)8-20(29)17-18(24-19(22)25-20)26(10-23-17)16-7-14(28)15(40-16)9-39-44(35,36)42-45(37,38)41-43(32,33)34/h3-4,6,10,14-16,28-29H,5,7-9,21H2,(H,35,36)(H,37,38)(H3,22,24,25)(H2,32,33,34)/t14-,15+,16+,20?/m0/s1 |
| InChIKey | SCSYCEBAKYYUTH-VZSIPSJESA-N |
| XLogP | -0.78 |
| TPSA | 346.90 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.38 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|