About barium(2+);bis(1,3-diphenylprop-2-enylbenzene)
barium(2+);bis(1,3-diphenylprop-2-enylbenzene) (PubChem CID 154250998) has the molecular formula C42H34Ba
and a molecular weight of 676.06 g/mol. Its IUPAC name is barium(2+);bis(1,3-diphenylprop-2-enylbenzene).
Molecular Properties
| Compound Name | barium(2+);bis(1,3-diphenylprop-2-enylbenzene) |
| PubChem CID | 154250998 |
| Molecular Formula | C42H34Ba |
| Molecular Weight | 676.06 g/mol |
| Exact Mass | 676.17 |
| IUPAC Name | barium(2+);bis(1,3-diphenylprop-2-enylbenzene) |
| SMILES | [Ba+2].[C-](=C/C(c1ccccc1)c1ccccc1)\c1ccccc1.[C-](=C\C(c1ccccc1)c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/2C21H17.Ba/c2*1-4-10-18(11-5-1)16-17-21(19-12-6-2-7-13-19)20-14-8-3-9-15-20;/h2*1-15,17,21H;/q2*-1;+2 |
| InChIKey | XRDARFZIAATLOD-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 676.06 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(1,3-diphenylprop-2-enylbenzene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(1,3-diphenylprop-2-enylbenzene)?
The IUPAC name of barium(2+);bis(1,3-diphenylprop-2-enylbenzene) (CID 154250998) is barium(2+);bis(1,3-diphenylprop-2-enylbenzene).
What is the SMILES notation for barium(2+);bis(1,3-diphenylprop-2-enylbenzene)?
The canonical SMILES for barium(2+);bis(1,3-diphenylprop-2-enylbenzene) is [Ba+2].[C-](=C/C(c1ccccc1)c1ccccc1)\c1ccccc1.[C-](=C\C(c1ccccc1)c1ccccc1)\c1ccccc1.
What is the InChIKey of barium(2+);bis(1,3-diphenylprop-2-enylbenzene)?
The InChIKey is XRDARFZIAATLOD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C21H17.Ba/c2*1-4-10-18(11-5-1)16-17-21(19-12-6-2-7-13-19)20-14-8-3-9-15-20;/h2*1-15,17,21H;/q2*-1;+2.
What are the key properties of barium(2+);bis(1,3-diphenylprop-2-enylbenzene)?
barium(2+);bis(1,3-diphenylprop-2-enylbenzene) has a molecular weight of 676.06 g/mol, XLogP of 10.07, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(1,3-diphenylprop-2-enylbenzene) is sourced from PubChem (CID 154250998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).