C17H10O — CID 154263401
6-methoxytricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,12,14-hexaen-2,10-diyne (PubChem CID 154263401) has the molecular formula C17H10O and a molecular weight of 230.27 g/mol. Its IUPAC name is 6-methoxytricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,12,14-hexaen-2,10-diyne.
| Compound Name | 6-methoxytricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,12,14-hexaen-2,10-diyne |
|---|---|
| PubChem CID | 154263401 |
| Molecular Formula | C17H10O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 6-methoxytricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,12,14-hexaen-2,10-diyne |
| SMILES | COc1ccc2c(c1)C#Cc1ccccc1C#C2 |
| InChI | InChI=1S/C17H10O/c1-18-17-11-10-15-7-6-13-4-2-3-5-14(13)8-9-16(15)12-17/h2-5,10-12H,1H3 |
| InChIKey | WCOZAXCHRVXPQU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|