C15H13ClF3N3O3S — CID 154356079
5-[(benzylamino)carbamoyl]-4-chloro-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 154356079) has the molecular formula C15H13ClF3N3O3S and a molecular weight of 407.80 g/mol. Its IUPAC name is 5-[(benzylamino)carbamoyl]-4-chloro-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 5-[(benzylamino)carbamoyl]-4-chloro-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 154356079 |
| Molecular Formula | C15H13ClF3N3O3S |
| Molecular Weight | 407.80 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 5-[(benzylamino)carbamoyl]-4-chloro-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NNCc2ccccc2)c(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C15H13ClF3N3O3S/c16-12-7-11(15(17,18)19)13(26(20,24)25)6-10(12)14(23)22-21-8-9-4-2-1-3-5-9/h1-7,21H,8H2,(H,22,23)(H2,20,24,25) |
| InChIKey | VJRFVLHXHHNBHW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.80 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|