C24H28O — CID 154367873
1-[[(1S,3S)-2,2-dimethyl-3-(4-methylpenta-1,3-dienyl)cyclopropyl]methyl]-3-phenoxybenzene (PubChem CID 154367873) has the molecular formula C24H28O and a molecular weight of 332.49 g/mol. Its IUPAC name is 1-[[(1S,3S)-2,2-dimethyl-3-(4-methylpenta-1,3-dienyl)cyclopropyl]methyl]-3-phenoxybenzene.
| Compound Name | 1-[[(1S,3S)-2,2-dimethyl-3-(4-methylpenta-1,3-dienyl)cyclopropyl]methyl]-3-phenoxybenzene |
|---|---|
| PubChem CID | 154367873 |
| Molecular Formula | C24H28O |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-[[(1S,3S)-2,2-dimethyl-3-(4-methylpenta-1,3-dienyl)cyclopropyl]methyl]-3-phenoxybenzene |
| SMILES | CC(C)=CC=C[C@H]1[C@H](Cc2cccc(Oc3ccccc3)c2)C1(C)C |
| InChI | InChI=1S/C24H28O/c1-18(2)10-8-15-22-23(24(22,3)4)17-19-11-9-14-21(16-19)25-20-12-6-5-7-13-20/h5-16,22-23H,17H2,1-4H3/t22-,23-/m0/s1 |
| InChIKey | RLFVRJHJNCNYRL-GOTSBHOMSA-N |
| XLogP | 6.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|