C16H28F3NO2 — CID 15438697
N,N-dibutyl-5-oxo-2-(trifluoromethyl)heptanamide (PubChem CID 15438697) has the molecular formula C16H28F3NO2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N,N-dibutyl-5-oxo-2-(trifluoromethyl)heptanamide.
| Compound Name | N,N-dibutyl-5-oxo-2-(trifluoromethyl)heptanamide |
|---|---|
| PubChem CID | 15438697 |
| Molecular Formula | C16H28F3NO2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N,N-dibutyl-5-oxo-2-(trifluoromethyl)heptanamide |
| SMILES | CCCCN(CCCC)C(=O)C(CCC(=O)CC)C(F)(F)F |
| InChI | InChI=1S/C16H28F3NO2/c1-4-7-11-20(12-8-5-2)15(22)14(16(17,18)19)10-9-13(21)6-3/h14H,4-12H2,1-3H3 |
| InChIKey | HOPGTQHXENBTDH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |