C21H40O6Si3 — CID 154387314
[4-[2-[bis(trimethylsilyloxy)methylsilyl]ethyl]-2-prop-2-enoyloxycyclohexyl] prop-2-enoate (PubChem CID 154387314) has the molecular formula C21H40O6Si3 and a molecular weight of 472.80 g/mol. Its IUPAC name is [4-[2-[bis(trimethylsilyloxy)methylsilyl]ethyl]-2-prop-2-enoyloxycyclohexyl] prop-2-enoate.
| Compound Name | [4-[2-[bis(trimethylsilyloxy)methylsilyl]ethyl]-2-prop-2-enoyloxycyclohexyl] prop-2-enoate |
|---|---|
| PubChem CID | 154387314 |
| Molecular Formula | C21H40O6Si3 |
| Molecular Weight | 472.80 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | [4-[2-[bis(trimethylsilyloxy)methylsilyl]ethyl]-2-prop-2-enoyloxycyclohexyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1CCC(CC[SiH2]C(O[Si](C)(C)C)O[Si](C)(C)C)CC1OC(=O)C=C |
| InChI | InChI=1S/C21H40O6Si3/c1-9-19(22)24-17-12-11-16(15-18(17)25-20(23)10-2)13-14-28-21(26-29(3,4)5)27-30(6,7)8/h9-10,16-18,21H,1-2,11-15,28H2,3-8H3 |
| InChIKey | OYLJYAVMGRQMOV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.80 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|