C19H23N3 — CID 154388626
2,4-bis(1,6-dimethylcyclohexa-2,4-dien-1-yl)-1,3,5-triazine (PubChem CID 154388626) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2,4-bis(1,6-dimethylcyclohexa-2,4-dien-1-yl)-1,3,5-triazine.
| Compound Name | 2,4-bis(1,6-dimethylcyclohexa-2,4-dien-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 154388626 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 2,4-bis(1,6-dimethylcyclohexa-2,4-dien-1-yl)-1,3,5-triazine |
| SMILES | CC1C=CC=CC1(C)c1ncnc(C2(C)C=CC=CC2C)n1 |
| InChI | InChI=1S/C19H23N3/c1-14-9-5-7-11-18(14,3)16-20-13-21-17(22-16)19(4)12-8-6-10-15(19)2/h5-15H,1-4H3 |
| InChIKey | QUGARBUWMZNRER-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |