C27H46O4Si — CID 154404421
propan-2-yl (Z)-7-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(cyclohexen-1-yl)-5-oxocyclopentyl]hept-5-enoate (PubChem CID 154404421) has the molecular formula C27H46O4Si and a molecular weight of 462.75 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(cyclohexen-1-yl)-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(cyclohexen-1-yl)-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 154404421 |
| Molecular Formula | C27H46O4Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(cyclohexen-1-yl)-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@H]1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C1=CCCCC1 |
| InChI | InChI=1S/C27H46O4Si/c1-20(2)30-25(29)18-14-9-8-13-17-22-23(28)19-24(31-32(6,7)27(3,4)5)26(22)21-15-11-10-12-16-21/h8,13,15,20,22,24,26H,9-12,14,16-19H2,1-7H3/b13-8-/t22-,24+,26+/m0/s1 |
| InChIKey | JYGQQHRURNBCIY-SQMXWTSDSA-N |
| XLogP | 7.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|