C26H23N5O3S2 — CID 154416988
2-(2-amino-1,3-thiazol-4-yl)-N-[(6R)-4-benzhydryl-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-hydroxyiminoacetamide (PubChem CID 154416988) has the molecular formula C26H23N5O3S2 and a molecular weight of 517.64 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[(6R)-4-benzhydryl-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-hydroxyiminoacetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[(6R)-4-benzhydryl-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-hydroxyiminoacetamide |
|---|---|
| PubChem CID | 154416988 |
| Molecular Formula | C26H23N5O3S2 |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[(6R)-4-benzhydryl-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-hydroxyiminoacetamide |
| SMILES | C=CC1=CN2C(=O)C(NC(=O)C(=NO)c3csc(N)n3)[C@H]2SC1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H23N5O3S2/c1-2-15-13-31-24(33)21(29-23(32)20(30-34)18-14-35-26(27)28-18)25(31)36-22(15)19(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h2-14,19,21-22,25,34H,1H2,(H2,27,28)(H,29,32)/t21?,22?,25-/m1/s1 |
| InChIKey | RGAQVTXONPIHEM-XUNZJTMSSA-N |
| XLogP | 3.57 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|