C31H27N7O3S2 — CID 158902554
2-(5-amino-1,2,4-thiadiazol-3-yl)-N-[(6R)-4-benzhydryl-8-oxo-3-(2-pyridin-3-ylethenyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-methoxyiminoacetamide (PubChem CID 158902554) has the molecular formula C31H27N7O3S2 and a molecular weight of 609.74 g/mol. Its IUPAC name is 2-(5-amino-1,2,4-thiadiazol-3-yl)-N-[(6R)-4-benzhydryl-8-oxo-3-(2-pyridin-3-ylethenyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-methoxyiminoacetamide.
| Compound Name | 2-(5-amino-1,2,4-thiadiazol-3-yl)-N-[(6R)-4-benzhydryl-8-oxo-3-(2-pyridin-3-ylethenyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-methoxyiminoacetamide |
|---|---|
| PubChem CID | 158902554 |
| Molecular Formula | C31H27N7O3S2 |
| Molecular Weight | 609.74 g/mol |
| Exact Mass | 609.16 |
| IUPAC Name | 2-(5-amino-1,2,4-thiadiazol-3-yl)-N-[(6R)-4-benzhydryl-8-oxo-3-(2-pyridin-3-ylethenyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-methoxyiminoacetamide |
| SMILES | CON=C(C(=O)NC1C(=O)N2C=C(C=Cc3cccnc3)C(C(c3ccccc3)c3ccccc3)S[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C31H27N7O3S2/c1-41-36-24(27-35-31(32)43-37-27)28(39)34-25-29(40)38-18-22(15-14-19-9-8-16-33-17-19)26(42-30(25)38)23(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-18,23,25-26,30H,1H3,(H,34,39)(H2,32,35,37)/t25?,26?,30-/m1/s1 |
| InChIKey | JFQACHGEUNEZHJ-GCPOPKDISA-N |
| XLogP | 4.06 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.74 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|