C33H34Cl2GeZr-2 — CID 154419933
dichloro-[methyl(phenyl)germylidene]zirconium;bis((2,4-dimethylcyclopenta-1,4-dien-1-yl)benzene) (PubChem CID 154419933) has the molecular formula C33H34Cl2GeZr-2 and a molecular weight of 665.38 g/mol. Its IUPAC name is dichloro-[methyl(phenyl)germylidene]zirconium;bis((2,4-dimethylcyclopenta-1,4-dien-1-yl)benzene).
| Compound Name | dichloro-[methyl(phenyl)germylidene]zirconium;bis((2,4-dimethylcyclopenta-1,4-dien-1-yl)benzene) |
|---|---|
| PubChem CID | 154419933 |
| Molecular Formula | C33H34Cl2GeZr-2 |
| Molecular Weight | 665.38 g/mol |
| Exact Mass | 664.03 |
| IUPAC Name | dichloro-[methyl(phenyl)germylidene]zirconium;bis((2,4-dimethylcyclopenta-1,4-dien-1-yl)benzene) |
| SMILES | C[Ge](c1ccccc1)=[Zr](Cl)Cl.Cc1cc(-c2ccccc2)c(C)[cH-]1.Cc1cc(-c2ccccc2)c(C)[cH-]1 |
| InChI | InChI=1S/2C13H13.C7H8Ge.2ClH.Zr/c2*1-10-8-11(2)13(9-10)12-6-4-3-5-7-12;1-8-7-5-3-2-4-6-7;;;/h2*3-9H,1-2H3;2-6H,1H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | RONHAPKCBUMGTI-UHFFFAOYSA-L |
| XLogP | 9.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.38 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|