C29H42Cl2SiZr-2 — CID 154441998
bis(2-tert-butyl-1,4-dimethylcyclopenta-1,3-diene);dichloro-[methyl(phenyl)silylidene]zirconium (PubChem CID 154441998) has the molecular formula C29H42Cl2SiZr-2 and a molecular weight of 580.87 g/mol. Its IUPAC name is bis(2-tert-butyl-1,4-dimethylcyclopenta-1,3-diene);dichloro-[methyl(phenyl)silylidene]zirconium.
| Compound Name | bis(2-tert-butyl-1,4-dimethylcyclopenta-1,3-diene);dichloro-[methyl(phenyl)silylidene]zirconium |
|---|---|
| PubChem CID | 154441998 |
| Molecular Formula | C29H42Cl2SiZr-2 |
| Molecular Weight | 580.87 g/mol |
| Exact Mass | 578.15 |
| IUPAC Name | bis(2-tert-butyl-1,4-dimethylcyclopenta-1,3-diene);dichloro-[methyl(phenyl)silylidene]zirconium |
| SMILES | C[Si](c1ccccc1)=[Zr](Cl)Cl.Cc1cc(C(C)(C)C)c(C)[cH-]1.Cc1cc(C(C)(C)C)c(C)[cH-]1 |
| InChI | InChI=1S/2C11H17.C7H8Si.2ClH.Zr/c2*1-8-6-9(2)10(7-8)11(3,4)5;1-8-7-5-3-2-4-6-7;;;/h2*6-7H,1-5H3;2-6H,1H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | OIKAXHQCKUWRNN-UHFFFAOYSA-L |
| XLogP | 9.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.87 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|