C21H26Cl2SiZr-2 — CID 154419852
cyclopenta-1,4-dien-1-ylbenzene;dichloro(dimethylsilylidene)zirconium;1,2,4-trimethylcyclopenta-1,3-diene (PubChem CID 154419852) has the molecular formula C21H26Cl2SiZr-2 and a molecular weight of 468.66 g/mol. Its IUPAC name is cyclopenta-1,4-dien-1-ylbenzene;dichloro(dimethylsilylidene)zirconium;1,2,4-trimethylcyclopenta-1,3-diene.
| Compound Name | cyclopenta-1,4-dien-1-ylbenzene;dichloro(dimethylsilylidene)zirconium;1,2,4-trimethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 154419852 |
| Molecular Formula | C21H26Cl2SiZr-2 |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | cyclopenta-1,4-dien-1-ylbenzene;dichloro(dimethylsilylidene)zirconium;1,2,4-trimethylcyclopenta-1,3-diene |
| SMILES | C[Si](C)=[Zr](Cl)Cl.Cc1cc(C)c(C)[cH-]1.c1ccc(-c2cc[cH-]c2)cc1 |
| InChI | InChI=1S/C11H9.C8H11.C2H6Si.2ClH.Zr/c1-2-6-10(7-3-1)11-8-4-5-9-11;1-6-4-7(2)8(3)5-6;1-3-2;;;/h1-9H;4-5H,1-3H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | MXWCBHSYQJJPEK-UHFFFAOYSA-L |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|