C20H26O5 — CID 154443720
10-hydroxy-8,9-dimethyl-5-propoxy-4-propyl-9,10-dihydro-8H-pyrano[2,3-h]chromen-2-one (PubChem CID 154443720) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is 10-hydroxy-8,9-dimethyl-5-propoxy-4-propyl-9,10-dihydro-8H-pyrano[2,3-h]chromen-2-one.
| Compound Name | 10-hydroxy-8,9-dimethyl-5-propoxy-4-propyl-9,10-dihydro-8H-pyrano[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 154443720 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 10-hydroxy-8,9-dimethyl-5-propoxy-4-propyl-9,10-dihydro-8H-pyrano[2,3-h]chromen-2-one |
| SMILES | CCCOc1cc2c(c3oc(=O)cc(CCC)c13)C(O)C(C)C(C)O2 |
| InChI | InChI=1S/C20H26O5/c1-5-7-13-9-16(21)25-20-17(13)14(23-8-6-2)10-15-18(20)19(22)11(3)12(4)24-15/h9-12,19,22H,5-8H2,1-4H3 |
| InChIKey | BUTQVXRICVCQRZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|