C43H37Br3O10 — CID 4529025
[17,18-bis[(4-bromobenzoyl)oxy]-4,5,16,16-tetramethyl-10-oxo-12-propyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),8(13),11-tetraen-6-yl] 4-bromobenzoate (PubChem CID 4529025) has the molecular formula C43H37Br3O10 and a molecular weight of 953.47 g/mol. Its IUPAC name is [17,18-bis[(4-bromobenzoyl)oxy]-4,5,16,16-tetramethyl-10-oxo-12-propyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),8(13),11-tetraen-6-yl] 4-bromobenzoate.
| Compound Name | [17,18-bis[(4-bromobenzoyl)oxy]-4,5,16,16-tetramethyl-10-oxo-12-propyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),8(13),11-tetraen-6-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 4529025 |
| Molecular Formula | C43H37Br3O10 |
| Molecular Weight | 953.47 g/mol |
| Exact Mass | 949.99 |
| IUPAC Name | [17,18-bis[(4-bromobenzoyl)oxy]-4,5,16,16-tetramethyl-10-oxo-12-propyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),8(13),11-tetraen-6-yl] 4-bromobenzoate |
| SMILES | CCCc1cc(=O)oc2c3c(c4c(c12)OC(C)(C)C(OC(=O)c1ccc(Br)cc1)C4OC(=O)c1ccc(Br)cc1)OC(C)C(C)C3OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C43H37Br3O10/c1-6-7-26-20-30(47)52-35-31(26)37-33(36-32(35)34(21(2)22(3)51-36)53-40(48)23-8-14-27(44)15-9-23)38(54-41(49)24-10-16-28(45)17-11-24)39(43(4,5)56-37)55-42(50)25-12-18-29(46)19-13-25/h8-22,34,38-39H,6-7H2,1-5H3 |
| InChIKey | XANZHMLKDMKPSX-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 127.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.47 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|